C15H22O3 — CID 123279542
3-(2-hydroxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one (PubChem CID 123279542) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one.
| Compound Name | 3-(2-hydroxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 123279542 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 3-(2-hydroxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one |
| SMILES | CCC=CCC(O)CC=C1CC(CCO)=CC1=O |
| InChI | InChI=1S/C15H22O3/c1-2-3-4-5-14(17)7-6-13-10-12(8-9-16)11-15(13)18/h3-4,6,11,14,16-17H,2,5,7-10H2,1H3 |
| InChIKey | YBOBBTOFWUSFJM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|