C19H20O4 — CID 123742286
(E)-4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-4-phenylbut-3-enoic acid (PubChem CID 123742286) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (E)-4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-4-phenylbut-3-enoic acid.
| Compound Name | (E)-4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-4-phenylbut-3-enoic acid |
|---|---|
| PubChem CID | 123742286 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (E)-4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-4-phenylbut-3-enoic acid |
| SMILES | Cc1c(C)c(O)c(/C(=C/CC(=O)O)c2ccccc2)c(C)c1O |
| InChI | InChI=1S/C19H20O4/c1-11-12(2)19(23)17(13(3)18(11)22)15(9-10-16(20)21)14-7-5-4-6-8-14/h4-9,22-23H,10H2,1-3H3,(H,20,21)/b15-9+ |
| InChIKey | LMXPFLKGSHARHZ-OQLLNIDSSA-N |
| XLogP | 3.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|