C15H26O4Si — CID 123742519
[5,6-bis(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]silane (PubChem CID 123742519) has the molecular formula C15H26O4Si and a molecular weight of 298.45 g/mol. Its IUPAC name is [5,6-bis(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]silane.
| Compound Name | [5,6-bis(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]silane |
|---|---|
| PubChem CID | 123742519 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [5,6-bis(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]silane |
| SMILES | [SiH3]C1CC2CC1C(COCC1CO1)C2COCC1CO1 |
| InChI | InChI=1S/C15H26O4Si/c20-15-2-9-1-12(15)14(8-17-4-11-6-19-11)13(9)7-16-3-10-5-18-10/h9-15H,1-8H2,20H3 |
| InChIKey | BHEZLDOFOAJTNW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|