About 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole
3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole (PubChem CID 123750733) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole.
Molecular Properties
| Compound Name | 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole |
| PubChem CID | 123750733 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole |
| SMILES | CCc1nn(C)c2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C12H20N2/c1-5-10-9-6-7-12(2,3)8-11(9)14(4)13-10/h5-8H2,1-4H3 |
| InChIKey | VLEVGFLEWIGADN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
The IUPAC name of 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole (CID 123750733) is 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole.
What is the SMILES notation for 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
The canonical SMILES for 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole is CCc1nn(C)c2c1CCC(C)(C)C2.
What is the InChIKey of 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
The InChIKey is VLEVGFLEWIGADN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-5-10-9-6-7-12(2,3)8-11(9)14(4)13-10/h5-8H2,1-4H3.
What are the key properties of 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole has a molecular weight of 192.31 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,6,6-trimethyl-5,7-dihydro-4H-indazole is sourced from PubChem (CID 123750733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).