C20H23F3N4O2 — CID 123755819
ethyl 2-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetate (PubChem CID 123755819) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is ethyl 2-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetate.
| Compound Name | ethyl 2-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 123755819 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | ethyl 2-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetate |
| SMILES | CCOC(=O)CC1CC(CC)C(c2nc(C(F)(F)F)c3cnc4[nH]ccc4n23)C1 |
| InChI | InChI=1S/C20H23F3N4O2/c1-3-12-7-11(9-16(28)29-4-2)8-13(12)19-26-17(20(21,22)23)15-10-25-18-14(27(15)19)5-6-24-18/h5-6,10-13,24H,3-4,7-9H2,1-2H3 |
| InChIKey | GLUBDUKQSRPZCN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |