10-silyloxysilyloxysilylundecanoic acid

C11H28O4Si3 — CID 123778053

IUPAC10-silyloxysilyloxysilylundecanoic acid
SMILESCC(CCCCCCCCC(=O)O)[SiH2]O[SiH2]O[SiH3]
InChIInChI=1S/C11H28O4Si3/c1-10(17-15-18-14-16)8-6-4-2-3-5-7-9-11(12)13/h10H,2-9,17-18H2,1,16H3,(H,12,13)
InChIKeyHKACLYSAHIJMPH-UHFFFAOYSA-N
MW308.60 g/mol
LogP0.40
Rot. Bonds13

About 10-silyloxysilyloxysilylundecanoic acid

10-silyloxysilyloxysilylundecanoic acid (PubChem CID 123778053) has the molecular formula C11H28O4Si3 and a molecular weight of 308.60 g/mol. Its IUPAC name is 10-silyloxysilyloxysilylundecanoic acid.

Molecular Properties

Compound Name10-silyloxysilyloxysilylundecanoic acid
PubChem CID123778053
Molecular FormulaC11H28O4Si3
Molecular Weight308.60 g/mol
Exact Mass308.13
IUPAC Name10-silyloxysilyloxysilylundecanoic acid
SMILESCC(CCCCCCCCC(=O)O)[SiH2]O[SiH2]O[SiH3]
InChIInChI=1S/C11H28O4Si3/c1-10(17-15-18-14-16)8-6-4-2-3-5-7-9-11(12)13/h10H,2-9,17-18H2,1,16H3,(H,12,13)
InChIKeyHKACLYSAHIJMPH-UHFFFAOYSA-N
XLogP0.40
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds13
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.60
LogP ≤ 50.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 10-silyloxysilyloxysilylundecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

19-methylheptatriacontanedioic acid
CID 141009772
16-methylheptadecanoic acid
CID 87200881
methoxymethane;16-methylheptadecanoic acid
CID 175921970
sodium;hydride;6-methylheptanoic acid
CID 174475906
azane;16-methylheptadecanoic acid
CID 161380406
8-methylnonanoic acid;zinc
CID 175431403
20-hydroxyhenicosanoic acid
CID 19591814
copper;6-methylheptanoic acid;7-methyloctanoic acid
CID 170842842
iron;6-methylheptanoic acid;7-methyloctanoic acid
CID 56844011
19-hydroxyicosanoic acid
CID 14535566
14-aminopentadecanoic acid
CID 87306551
15-bromohexadecanoic acid
CID 22242436

Frequently Asked Questions

What is the IUPAC name of 10-silyloxysilyloxysilylundecanoic acid?
The IUPAC name of 10-silyloxysilyloxysilylundecanoic acid (CID 123778053) is 10-silyloxysilyloxysilylundecanoic acid.
What is the SMILES notation for 10-silyloxysilyloxysilylundecanoic acid?
The canonical SMILES for 10-silyloxysilyloxysilylundecanoic acid is CC(CCCCCCCCC(=O)O)[SiH2]O[SiH2]O[SiH3].
What is the InChIKey of 10-silyloxysilyloxysilylundecanoic acid?
The InChIKey is HKACLYSAHIJMPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28O4Si3/c1-10(17-15-18-14-16)8-6-4-2-3-5-7-9-11(12)13/h10H,2-9,17-18H2,1,16H3,(H,12,13).
What are the key properties of 10-silyloxysilyloxysilylundecanoic acid?
10-silyloxysilyloxysilylundecanoic acid has a molecular weight of 308.60 g/mol, XLogP of 0.40, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-silyloxysilyloxysilylundecanoic acid is sourced from PubChem (CID 123778053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).