C26H46O3 — CID 123779515
5-[1-(2-cyclohexyloxyethoxy)ethoxy]-2-(2,2,6-trimethylheptan-4-yl)cyclohexa-1,3-diene (PubChem CID 123779515) has the molecular formula C26H46O3 and a molecular weight of 406.65 g/mol. Its IUPAC name is 5-[1-(2-cyclohexyloxyethoxy)ethoxy]-2-(2,2,6-trimethylheptan-4-yl)cyclohexa-1,3-diene.
| Compound Name | 5-[1-(2-cyclohexyloxyethoxy)ethoxy]-2-(2,2,6-trimethylheptan-4-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123779515 |
| Molecular Formula | C26H46O3 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | 5-[1-(2-cyclohexyloxyethoxy)ethoxy]-2-(2,2,6-trimethylheptan-4-yl)cyclohexa-1,3-diene |
| SMILES | CC(C)CC(CC(C)(C)C)C1=CCC(OC(C)OCCOC2CCCCC2)C=C1 |
| InChI | InChI=1S/C26H46O3/c1-20(2)18-23(19-26(4,5)6)22-12-14-25(15-13-22)29-21(3)27-16-17-28-24-10-8-7-9-11-24/h12-14,20-21,23-25H,7-11,15-19H2,1-6H3 |
| InChIKey | VTNRQDRWZZGMDE-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|