C35H44N2O5S — CID 123784045
4-[(2E)-1-ethyl-2-[(2E,4E)-5-[1-ethyl-3-methyl-3-(3-oxidoperoxysulfanylpropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,5-dimethylindol-3-yl]butanoic acid (PubChem CID 123784045) has the molecular formula C35H44N2O5S and a molecular weight of 604.81 g/mol. Its IUPAC name is 4-[(2E)-1-ethyl-2-[(2E,4E)-5-[1-ethyl-3-methyl-3-(3-oxidoperoxysulfanylpropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,5-dimethylindol-3-yl]butanoic acid.
| Compound Name | 4-[(2E)-1-ethyl-2-[(2E,4E)-5-[1-ethyl-3-methyl-3-(3-oxidoperoxysulfanylpropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,5-dimethylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 123784045 |
| Molecular Formula | C35H44N2O5S |
| Molecular Weight | 604.81 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 4-[(2E)-1-ethyl-2-[(2E,4E)-5-[1-ethyl-3-methyl-3-(3-oxidoperoxysulfanylpropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,5-dimethylindol-3-yl]butanoic acid |
| SMILES | CCN1/C(=C/C=C/C=C/C2=[N+](CC)c3ccccc3C2(C)CCCSOO[O-])C(C)(CCCC(=O)O)c2cc(C)ccc21 |
| InChI | InChI=1S/C35H44N2O5S/c1-6-36-29-16-12-11-15-27(29)34(4,23-14-24-43-42-41-40)31(36)17-9-8-10-18-32-35(5,22-13-19-33(38)39)28-25-26(3)20-21-30(28)37(32)7-2/h8-12,15-18,20-21,25H,6-7,13-14,19,22-24H2,1-5H3,(H-,38,39,40) |
| InChIKey | OHHPWKRMICGBLX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.81 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|