C24H22O3 — CID 123787066
4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde (PubChem CID 123787066) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde.
| Compound Name | 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde |
|---|---|
| PubChem CID | 123787066 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde |
| SMILES | COc1ccc2c(c1)-c1cc(OC)ccc1C2CCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C24H22O3/c1-26-18-8-11-21-20(10-7-16-3-5-17(15-25)6-4-16)22-12-9-19(27-2)14-24(22)23(21)13-18/h3-6,8-9,11-15,20H,7,10H2,1-2H3 |
| InChIKey | NCHANIBVDDCXQS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|