About 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde
4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde (PubChem CID 123787066) has the molecular formula C24H22O3
and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde |
| PubChem CID | 123787066 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde |
| SMILES | COc1ccc2c(c1)-c1cc(OC)ccc1C2CCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C24H22O3/c1-26-18-8-11-21-20(10-7-16-3-5-17(15-25)6-4-16)22-12-9-19(27-2)14-24(22)23(21)13-18/h3-6,8-9,11-15,20H,7,10H2,1-2H3 |
| InChIKey | NCHANIBVDDCXQS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde?
The IUPAC name of 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde (CID 123787066) is 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde.
What is the SMILES notation for 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde?
The canonical SMILES for 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde is COc1ccc2c(c1)-c1cc(OC)ccc1C2CCc1ccc(C=O)cc1.
What is the InChIKey of 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde?
The InChIKey is NCHANIBVDDCXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O3/c1-26-18-8-11-21-20(10-7-16-3-5-17(15-25)6-4-16)22-12-9-19(27-2)14-24(22)23(21)13-18/h3-6,8-9,11-15,20H,7,10H2,1-2H3.
What are the key properties of 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde?
4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde has a molecular weight of 358.44 g/mol, XLogP of 5.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,6-dimethoxy-9H-fluoren-9-yl)ethyl]benzaldehyde is sourced from PubChem (CID 123787066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).