C23H18ClN6O2+ — CID 123797352
1-(1,3-benzodioxol-5-yl)-2-(2-chloro-7H-purin-9-ium-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 123797352) has the molecular formula C23H18ClN6O2+ and a molecular weight of 445.89 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2-chloro-7H-purin-9-ium-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2-chloro-7H-purin-9-ium-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 123797352 |
| Molecular Formula | C23H18ClN6O2+ |
| Molecular Weight | 445.89 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2-chloro-7H-purin-9-ium-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Clc1nc(N2CCc3c([nH]c4ccccc34)C2c2ccc3c(c2)OCO3)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C23H17ClN6O2/c24-23-28-21-19(25-10-26-21)22(29-23)30-8-7-14-13-3-1-2-4-15(13)27-18(14)20(30)12-5-6-16-17(9-12)32-11-31-16/h1-6,9-10,20,27H,7-8,11H2,(H,25,26,28,29)/p+1 |
| InChIKey | CIVMEHHYKXNESQ-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|