C28H33FN+ — CID 123801194
7-butyl-6,7-diethyl-9-fluoro-3-methyl-10-phenyl-6H-benzo[a]quinolizin-5-ium (PubChem CID 123801194) has the molecular formula C28H33FN+ and a molecular weight of 402.58 g/mol. Its IUPAC name is 7-butyl-6,7-diethyl-9-fluoro-3-methyl-10-phenyl-6H-benzo[a]quinolizin-5-ium.
| Compound Name | 7-butyl-6,7-diethyl-9-fluoro-3-methyl-10-phenyl-6H-benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123801194 |
| Molecular Formula | C28H33FN+ |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 7-butyl-6,7-diethyl-9-fluoro-3-methyl-10-phenyl-6H-benzo[a]quinolizin-5-ium |
| SMILES | CCCCC1(CC)c2cc(F)c(-c3ccccc3)cc2-c2ccc(C)c[n+]2C1CC |
| InChI | InChI=1S/C28H33FN/c1-5-8-16-28(7-3)24-18-25(29)22(21-12-10-9-11-13-21)17-23(24)26-15-14-20(4)19-30(26)27(28)6-2/h9-15,17-19,27H,5-8,16H2,1-4H3/q+1 |
| InChIKey | XKEYJVHOAIFCPM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|