C47H42F4N2O4S — CID 123806523
[[[11-(2-ethylhexyl)-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate (PubChem CID 123806523) has the molecular formula C47H42F4N2O4S and a molecular weight of 806.92 g/mol. Its IUPAC name is [[[11-(2-ethylhexyl)-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate.
| Compound Name | [[[11-(2-ethylhexyl)-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 123806523 |
| Molecular Formula | C47H42F4N2O4S |
| Molecular Weight | 806.92 g/mol |
| Exact Mass | 806.28 |
| IUPAC Name | [[[11-(2-ethylhexyl)-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NOC(=O)c3cccs3)c3ccccc3OCC(F)(F)C(F)F)cc2c2cc(C(=O)c3ccccc3C)c3ccccc3c21 |
| InChI | InChI=1S/C47H42F4N2O4S/c1-4-6-15-30(5-2)27-53-39-23-22-31(25-36(39)37-26-38(33-17-9-10-18-34(33)43(37)53)44(54)32-16-8-7-14-29(32)3)42(52-57-45(55)41-21-13-24-58-41)35-19-11-12-20-40(35)56-28-47(50,51)46(48)49/h7-14,16-26,30,46H,4-6,15,27-28H2,1-3H3 |
| InChIKey | QCSOQMISVOZYJM-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.92 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|