C31H42O6 — CID 123808721
9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]but-3-enyl]fluorene (PubChem CID 123808721) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is 9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]but-3-enyl]fluorene.
| Compound Name | 9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]but-3-enyl]fluorene |
|---|---|
| PubChem CID | 123808721 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | 9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]but-3-enyl]fluorene |
| SMILES | C=CC(CC1(CC(C=C)OCCOCCOC)c2ccccc2-c2ccccc21)OCCOCCOC |
| InChI | InChI=1S/C31H42O6/c1-5-25(36-21-19-34-17-15-32-3)23-31(24-26(6-2)37-22-20-35-18-16-33-4)29-13-9-7-11-27(29)28-12-8-10-14-30(28)31/h5-14,25-26H,1-2,15-24H2,3-4H3 |
| InChIKey | HENNYDRZWUVACS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|