C8H17ClN2O2 — CID 123810886
N-(6-aminohexyl)-2-chloro-N-hydroxyacetamide (PubChem CID 123810886) has the molecular formula C8H17ClN2O2 and a molecular weight of 208.69 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-chloro-N-hydroxyacetamide.
| Compound Name | N-(6-aminohexyl)-2-chloro-N-hydroxyacetamide |
|---|---|
| PubChem CID | 123810886 |
| Molecular Formula | C8H17ClN2O2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-(6-aminohexyl)-2-chloro-N-hydroxyacetamide |
| SMILES | NCCCCCCN(O)C(=O)CCl |
| InChI | InChI=1S/C8H17ClN2O2/c9-7-8(12)11(13)6-4-2-1-3-5-10/h13H,1-7,10H2 |
| InChIKey | AMJMYNNWBARIGK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|