C26H28F3N5O5S — CID 123817629
tert-butyl N-[4-[6-[[amino-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]methylidene]amino]-3-pyridinyl]phenyl]carbamate (PubChem CID 123817629) has the molecular formula C26H28F3N5O5S and a molecular weight of 579.60 g/mol. Its IUPAC name is tert-butyl N-[4-[6-[[amino-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]methylidene]amino]-3-pyridinyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[6-[[amino-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]methylidene]amino]-3-pyridinyl]phenyl]carbamate |
|---|---|
| PubChem CID | 123817629 |
| Molecular Formula | C26H28F3N5O5S |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | tert-butyl N-[4-[6-[[amino-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]methylidene]amino]-3-pyridinyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2ccc(/N=C(\N)Nc3ccc(S(C)(=O)=O)cc3OCC(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C26H28F3N5O5S/c1-25(2,3)39-24(35)32-18-8-5-16(6-9-18)17-7-12-22(31-14-17)34-23(30)33-20-11-10-19(40(4,36)37)13-21(20)38-15-26(27,28)29/h5-14H,15H2,1-4H3,(H,32,35)(H3,30,31,33,34) |
| InChIKey | JLFKPXJCUDDXFB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|