C25H32F2 — CID 123821315
1-(3,4-difluorophenyl)-4-(4-hexylcyclohexyl)cyclohepta-1,3,5-triene (PubChem CID 123821315) has the molecular formula C25H32F2 and a molecular weight of 370.53 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-(4-hexylcyclohexyl)cyclohepta-1,3,5-triene.
| Compound Name | 1-(3,4-difluorophenyl)-4-(4-hexylcyclohexyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123821315 |
| Molecular Formula | C25H32F2 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-(4-hexylcyclohexyl)cyclohepta-1,3,5-triene |
| SMILES | CCCCCCC1CCC(C2=CC=C(c3ccc(F)c(F)c3)CC=C2)CC1 |
| InChI | InChI=1S/C25H32F2/c1-2-3-4-5-7-19-10-12-22(13-11-19)20-8-6-9-21(15-14-20)23-16-17-24(26)25(27)18-23/h6,8,14-19,22H,2-5,7,9-13H2,1H3 |
| InChIKey | MESYTDKDMLONKT-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|