C11H11NO4 — CID 123835412
5-hydroxy-4-(phenylmethoxymethyl)-3H-1,3-oxazol-2-one (PubChem CID 123835412) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 5-hydroxy-4-(phenylmethoxymethyl)-3H-1,3-oxazol-2-one.
| Compound Name | 5-hydroxy-4-(phenylmethoxymethyl)-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 123835412 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-hydroxy-4-(phenylmethoxymethyl)-3H-1,3-oxazol-2-one |
| SMILES | O=c1[nH]c(COCc2ccccc2)c(O)o1 |
| InChI | InChI=1S/C11H11NO4/c13-10-9(12-11(14)16-10)7-15-6-8-4-2-1-3-5-8/h1-5,13H,6-7H2,(H,12,14) |
| InChIKey | OOMNPNRCNSEZLC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |