C28H46N2O8 — CID 123838257
(2,5-dihydroxypyrrol-1-yl) 3-[3-[(4-dec-1-en-5-yloxy-4-oxobutanoyl)amino]-3-methylbutoxy]-3-methylbutanoate (PubChem CID 123838257) has the molecular formula C28H46N2O8 and a molecular weight of 538.68 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[3-[(4-dec-1-en-5-yloxy-4-oxobutanoyl)amino]-3-methylbutoxy]-3-methylbutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[3-[(4-dec-1-en-5-yloxy-4-oxobutanoyl)amino]-3-methylbutoxy]-3-methylbutanoate |
|---|---|
| PubChem CID | 123838257 |
| Molecular Formula | C28H46N2O8 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[3-[(4-dec-1-en-5-yloxy-4-oxobutanoyl)amino]-3-methylbutoxy]-3-methylbutanoate |
| SMILES | C=CCCC(CCCCC)OC(=O)CCC(=O)NC(C)(C)CCOC(C)(C)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C28H46N2O8/c1-7-9-11-13-21(12-10-8-2)37-25(34)17-14-22(31)29-27(3,4)18-19-36-28(5,6)20-26(35)38-30-23(32)15-16-24(30)33/h8,15-16,21,32-33H,2,7,9-14,17-20H2,1,3-6H3,(H,29,31) |
| InChIKey | RJJNECDEBCMBBI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|