C15H13F3N4O2 — CID 123840119
1-propyl-2-[3-(trifluoromethyl)phenoxy]-7H-purin-6-one (PubChem CID 123840119) has the molecular formula C15H13F3N4O2 and a molecular weight of 338.29 g/mol. Its IUPAC name is 1-propyl-2-[3-(trifluoromethyl)phenoxy]-7H-purin-6-one.
| Compound Name | 1-propyl-2-[3-(trifluoromethyl)phenoxy]-7H-purin-6-one |
|---|---|
| PubChem CID | 123840119 |
| Molecular Formula | C15H13F3N4O2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-propyl-2-[3-(trifluoromethyl)phenoxy]-7H-purin-6-one |
| SMILES | CCCn1c(Oc2cccc(C(F)(F)F)c2)nc2nc[nH]c2c1=O |
| InChI | InChI=1S/C15H13F3N4O2/c1-2-6-22-13(23)11-12(20-8-19-11)21-14(22)24-10-5-3-4-9(7-10)15(16,17)18/h3-5,7-8H,2,6H2,1H3,(H,19,20) |
| InChIKey | COXWVVGCSXRUAP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |