C12H38O3Si6 — CID 123843236
1,1-bis(trimethylsilyloxysilyl)propan-2-ylsilyloxy-trimethylsilane (PubChem CID 123843236) has the molecular formula C12H38O3Si6 and a molecular weight of 398.95 g/mol. Its IUPAC name is 1,1-bis(trimethylsilyloxysilyl)propan-2-ylsilyloxy-trimethylsilane.
| Compound Name | 1,1-bis(trimethylsilyloxysilyl)propan-2-ylsilyloxy-trimethylsilane |
|---|---|
| PubChem CID | 123843236 |
| Molecular Formula | C12H38O3Si6 |
| Molecular Weight | 398.95 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1,1-bis(trimethylsilyloxysilyl)propan-2-ylsilyloxy-trimethylsilane |
| SMILES | CC([SiH2]O[Si](C)(C)C)C([SiH2]O[Si](C)(C)C)[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C12H38O3Si6/c1-11(16-13-19(2,3)4)12(17-14-20(5,6)7)18-15-21(8,9)10/h11-12H,16-18H2,1-10H3 |
| InChIKey | LUJZCZUDKLTWPX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.95 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|