C10H34O5Si6 — CID 151495245
[dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilyloxysilyloxysilane (PubChem CID 151495245) has the molecular formula C10H34O5Si6 and a molecular weight of 402.89 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilyloxysilyloxysilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilyloxysilyloxysilane |
|---|---|
| PubChem CID | 151495245 |
| Molecular Formula | C10H34O5Si6 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilyloxysilyloxysilane |
| SMILES | C[Si](C)(C)O[SiH2]O[SiH2]O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H34O5Si6/c1-18(2,3)12-16-11-17-13-20(7,8)15-21(9,10)14-19(4,5)6/h16-17H2,1-10H3 |
| InChIKey | PPHCXMDLCFJMNI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|