C15H40O6Si5 — CID 123341317
2-[[dimethyl(trimethylsilyloxysilyloxysilyloxy)silyl]oxy-dimethylsilyl]ethyl 2,2-dimethylbutanoate (PubChem CID 123341317) has the molecular formula C15H40O6Si5 and a molecular weight of 456.91 g/mol. Its IUPAC name is 2-[[dimethyl(trimethylsilyloxysilyloxysilyloxy)silyl]oxy-dimethylsilyl]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[dimethyl(trimethylsilyloxysilyloxysilyloxy)silyl]oxy-dimethylsilyl]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123341317 |
| Molecular Formula | C15H40O6Si5 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[[dimethyl(trimethylsilyloxysilyloxysilyloxy)silyl]oxy-dimethylsilyl]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC[Si](C)(C)O[Si](C)(C)O[SiH2]O[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C15H40O6Si5/c1-11-15(2,3)14(16)17-12-13-25(7,8)21-26(9,10)20-23-18-22-19-24(4,5)6/h11-13,22-23H2,1-10H3 |
| InChIKey | UMEHUWHJENIWQJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|