C18H18N6O3S — CID 123846933
2-[[[[3-(2-amino-1H-indol-5-yl)-5-nitrosophenyl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid (PubChem CID 123846933) has the molecular formula C18H18N6O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is 2-[[[[3-(2-amino-1H-indol-5-yl)-5-nitrosophenyl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid.
| Compound Name | 2-[[[[3-(2-amino-1H-indol-5-yl)-5-nitrosophenyl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 123846933 |
| Molecular Formula | C18H18N6O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[[[[3-(2-amino-1H-indol-5-yl)-5-nitrosophenyl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid |
| SMILES | NNC(=NCSCC(=O)O)c1cc(N=O)cc(-c2ccc3[nH]c(N)cc3c2)c1 |
| InChI | InChI=1S/C18H18N6O3S/c19-16-7-12-3-10(1-2-15(12)22-16)11-4-13(6-14(5-11)24-27)18(23-20)21-9-28-8-17(25)26/h1-7,22H,8-9,19-20H2,(H,21,23)(H,25,26) |
| InChIKey | GACFIDQUKXMGHO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|