C13H25N3 — CID 123867907
2-N,4-N-dimethyl-3-[3-(propan-2-ylideneamino)propyl]pentane-2,4-diimine (PubChem CID 123867907) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-3-[3-(propan-2-ylideneamino)propyl]pentane-2,4-diimine.
| Compound Name | 2-N,4-N-dimethyl-3-[3-(propan-2-ylideneamino)propyl]pentane-2,4-diimine |
|---|---|
| PubChem CID | 123867907 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-N,4-N-dimethyl-3-[3-(propan-2-ylideneamino)propyl]pentane-2,4-diimine |
| SMILES | C/N=C(\C)C(CCCN=C(C)C)/C(C)=N/C |
| InChI | InChI=1S/C13H25N3/c1-10(2)16-9-7-8-13(11(3)14-5)12(4)15-6/h13H,7-9H2,1-6H3/b14-11+,15-12+ |
| InChIKey | GSYHTSKERPTMHA-LCPPQYOVSA-N |
| XLogP | 3.05 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|