C8H18N2O2 — CID 129031599
2-amino-5-(propan-2-ylideneamino)pentane-1,1-diol (PubChem CID 129031599) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-amino-5-(propan-2-ylideneamino)pentane-1,1-diol.
| Compound Name | 2-amino-5-(propan-2-ylideneamino)pentane-1,1-diol |
|---|---|
| PubChem CID | 129031599 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-amino-5-(propan-2-ylideneamino)pentane-1,1-diol |
| SMILES | CC(C)=NCCCC(N)C(O)O |
| InChI | InChI=1S/C8H18N2O2/c1-6(2)10-5-3-4-7(9)8(11)12/h7-8,11-12H,3-5,9H2,1-2H3 |
| InChIKey | SXUNHPVBRBIORV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|