C5H15BN4O2 — CID 3482116
[1-amino-4-(diaminomethylideneamino)butyl]boronic acid (PubChem CID 3482116) has the molecular formula C5H15BN4O2 and a molecular weight of 174.01 g/mol. Its IUPAC name is [1-amino-4-(diaminomethylideneamino)butyl]boronic acid.
| Compound Name | [1-amino-4-(diaminomethylideneamino)butyl]boronic acid |
|---|---|
| PubChem CID | 3482116 |
| Molecular Formula | C5H15BN4O2 |
| Molecular Weight | 174.01 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | [1-amino-4-(diaminomethylideneamino)butyl]boronic acid |
| SMILES | NC(N)=NCCCC(N)B(O)O |
| InChI | InChI=1S/C5H15BN4O2/c7-4(6(11)12)2-1-3-10-5(8)9/h4,11-12H,1-3,7H2,(H4,8,9,10) |
| InChIKey | ACTXPNAHMKBUTO-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.01 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|