C9H13F5OS — CID 123870607
3-methyl-5-(pentafluoro-λ6-sulfanyl)octa-3,5-dien-2-one (PubChem CID 123870607) has the molecular formula C9H13F5OS and a molecular weight of 264.26 g/mol. Its IUPAC name is 3-methyl-5-(pentafluoro-λ6-sulfanyl)octa-3,5-dien-2-one.
| Compound Name | 3-methyl-5-(pentafluoro-λ6-sulfanyl)octa-3,5-dien-2-one |
|---|---|
| PubChem CID | 123870607 |
| Molecular Formula | C9H13F5OS |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-methyl-5-(pentafluoro-λ6-sulfanyl)octa-3,5-dien-2-one |
| SMILES | CCC=C(C=C(C)C(C)=O)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C9H13F5OS/c1-4-5-9(6-7(2)8(3)15)16(10,11,12,13)14/h5-6H,4H2,1-3H3 |
| InChIKey | BPAHUZXAKDBIPM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|