C25H29NO5 — CID 123872786
(2R,3R,6S)-6-[4-(cyclopropylmethoxy)phenyl]-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxyheptane-1,4-dione (PubChem CID 123872786) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (2R,3R,6S)-6-[4-(cyclopropylmethoxy)phenyl]-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxyheptane-1,4-dione.
| Compound Name | (2R,3R,6S)-6-[4-(cyclopropylmethoxy)phenyl]-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxyheptane-1,4-dione |
|---|---|
| PubChem CID | 123872786 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (2R,3R,6S)-6-[4-(cyclopropylmethoxy)phenyl]-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxyheptane-1,4-dione |
| SMILES | C[C@@H](CC(=O)[C@H](O)[C@@H](O)C(=O)N1Cc2ccccc2C1)c1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C25H29NO5/c1-16(18-8-10-21(11-9-18)31-15-17-6-7-17)12-22(27)23(28)24(29)25(30)26-13-19-4-2-3-5-20(19)14-26/h2-5,8-11,16-17,23-24,28-29H,6-7,12-15H2,1H3/t16-,23-,24+/m0/s1 |
| InChIKey | XYDONDPFPWERQV-VVMYJBMMSA-N |
| XLogP | 2.80 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |