C6H13BO3 — CID 123875514
(2,5-dimethyl-1,3,2-dioxaborinan-5-yl)methanol (PubChem CID 123875514) has the molecular formula C6H13BO3 and a molecular weight of 143.98 g/mol. Its IUPAC name is (2,5-dimethyl-1,3,2-dioxaborinan-5-yl)methanol.
| Compound Name | (2,5-dimethyl-1,3,2-dioxaborinan-5-yl)methanol |
|---|---|
| PubChem CID | 123875514 |
| Molecular Formula | C6H13BO3 |
| Molecular Weight | 143.98 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (2,5-dimethyl-1,3,2-dioxaborinan-5-yl)methanol |
| SMILES | CB1OCC(C)(CO)CO1 |
| InChI | InChI=1S/C6H13BO3/c1-6(3-8)4-9-7(2)10-5-6/h8H,3-5H2,1-2H3 |
| InChIKey | MQYDCLBILQESQI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.98 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|