C16H26O3 — CID 177083692
[2-(1-adamantyl)-5-methyl-1,3-dioxan-5-yl]methanol (PubChem CID 177083692) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is [2-(1-adamantyl)-5-methyl-1,3-dioxan-5-yl]methanol.
| Compound Name | [2-(1-adamantyl)-5-methyl-1,3-dioxan-5-yl]methanol |
|---|---|
| PubChem CID | 177083692 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [2-(1-adamantyl)-5-methyl-1,3-dioxan-5-yl]methanol |
| SMILES | CC1(CO)COC(C23CC4CC(CC(C4)C2)C3)OC1 |
| InChI | InChI=1S/C16H26O3/c1-15(8-17)9-18-14(19-10-15)16-5-11-2-12(6-16)4-13(3-11)7-16/h11-14,17H,2-10H2,1H3 |
| InChIKey | AQVTWFLDZYVBSE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |