C12H17BO3 — CID 100941336
[5-methyl-2-(4-methylphenyl)-1,3,2-dioxaborinan-5-yl]methanol (PubChem CID 100941336) has the molecular formula C12H17BO3 and a molecular weight of 220.08 g/mol. Its IUPAC name is [5-methyl-2-(4-methylphenyl)-1,3,2-dioxaborinan-5-yl]methanol.
| Compound Name | [5-methyl-2-(4-methylphenyl)-1,3,2-dioxaborinan-5-yl]methanol |
|---|---|
| PubChem CID | 100941336 |
| Molecular Formula | C12H17BO3 |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [5-methyl-2-(4-methylphenyl)-1,3,2-dioxaborinan-5-yl]methanol |
| SMILES | Cc1ccc(B2OCC(C)(CO)CO2)cc1 |
| InChI | InChI=1S/C12H17BO3/c1-10-3-5-11(6-4-10)13-15-8-12(2,7-14)9-16-13/h3-6,14H,7-9H2,1-2H3 |
| InChIKey | CJXSYAWYJBUJQP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|