C25H30O4 — CID 123878461
2,15,18,18-tetramethyl-2-(3-methylbut-2-enyl)-11,17-dioxapentacyclo[11.3.2.01,12.03,12.05,10]octadeca-5,7,9-triene-4,16-dione (PubChem CID 123878461) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2,15,18,18-tetramethyl-2-(3-methylbut-2-enyl)-11,17-dioxapentacyclo[11.3.2.01,12.03,12.05,10]octadeca-5,7,9-triene-4,16-dione.
| Compound Name | 2,15,18,18-tetramethyl-2-(3-methylbut-2-enyl)-11,17-dioxapentacyclo[11.3.2.01,12.03,12.05,10]octadeca-5,7,9-triene-4,16-dione |
|---|---|
| PubChem CID | 123878461 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2,15,18,18-tetramethyl-2-(3-methylbut-2-enyl)-11,17-dioxapentacyclo[11.3.2.01,12.03,12.05,10]octadeca-5,7,9-triene-4,16-dione |
| SMILES | CC(C)=CCC1(C)C2C(=O)c3ccccc3OC23C2CC(C)C(=O)C13OC2(C)C |
| InChI | InChI=1S/C25H30O4/c1-14(2)11-12-23(6)20-19(26)16-9-7-8-10-17(16)28-24(20)18-13-15(3)21(27)25(23,24)29-22(18,4)5/h7-11,15,18,20H,12-13H2,1-6H3 |
| InChIKey | NWTYUKUXIRSXNQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|