C24H26O4 — CID 44551530
12,17,17-trimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione (PubChem CID 44551530) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 12,17,17-trimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione.
| Compound Name | 12,17,17-trimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 44551530 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 12,17,17-trimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
| SMILES | CC(C)=CCC12OC(C)(C)C3CC(C1=O)C(C)=C1C(=O)c4ccccc4OC132 |
| InChI | InChI=1S/C24H26O4/c1-13(2)10-11-23-21(26)16-12-18(22(4,5)28-23)24(23)19(14(16)3)20(25)15-8-6-7-9-17(15)27-24/h6-10,16,18H,11-12H2,1-5H3 |
| InChIKey | DKDGPOLLVNVQMP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|