C16H20Cl2O — CID 123879774
1-(5-chlorocyclohexa-1,3-dien-1-yl)-1-(5-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol (PubChem CID 123879774) has the molecular formula C16H20Cl2O and a molecular weight of 299.24 g/mol. Its IUPAC name is 1-(5-chlorocyclohexa-1,3-dien-1-yl)-1-(5-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol.
| Compound Name | 1-(5-chlorocyclohexa-1,3-dien-1-yl)-1-(5-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 123879774 |
| Molecular Formula | C16H20Cl2O |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(5-chlorocyclohexa-1,3-dien-1-yl)-1-(5-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol |
| SMILES | CCC(O)C(C1=CC=CC(Cl)C1)C1C=CC=C(Cl)C1 |
| InChI | InChI=1S/C16H20Cl2O/c1-2-15(19)16(11-5-3-7-13(17)9-11)12-6-4-8-14(18)10-12/h3-8,11,14-16,19H,2,9-10H2,1H3 |
| InChIKey | IIYKSCDTGBTNKB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|