C36H28N2O4S2 — CID 123881449
2-cyano-3-[7-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethyl]thieno[3,2-e][1]benzothiol-2-yl]prop-2-enoic acid (PubChem CID 123881449) has the molecular formula C36H28N2O4S2 and a molecular weight of 616.76 g/mol. Its IUPAC name is 2-cyano-3-[7-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethyl]thieno[3,2-e][1]benzothiol-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[7-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethyl]thieno[3,2-e][1]benzothiol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123881449 |
| Molecular Formula | C36H28N2O4S2 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 2-cyano-3-[7-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethyl]thieno[3,2-e][1]benzothiol-2-yl]prop-2-enoic acid |
| SMILES | COc1ccc(N(c2ccc(CCc3cc4c(ccc5sc(C=C(C#N)C(=O)O)cc54)s3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H28N2O4S2/c1-41-28-12-8-26(9-13-28)38(27-10-14-29(42-2)15-11-27)25-6-3-23(4-7-25)5-16-30-20-32-33-21-31(19-24(22-37)36(39)40)44-35(33)18-17-34(32)43-30/h3-4,6-15,17-21H,5,16H2,1-2H3,(H,39,40) |
| InChIKey | BOPJKRHXNVQQDX-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|