C10H12FN5O4 — CID 123887425
5-[(2R,3R,4R)-3-azido-4-fluoro-2-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione (PubChem CID 123887425) has the molecular formula C10H12FN5O4 and a molecular weight of 285.24 g/mol. Its IUPAC name is 5-[(2R,3R,4R)-3-azido-4-fluoro-2-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-[(2R,3R,4R)-3-azido-4-fluoro-2-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123887425 |
| Molecular Formula | C10H12FN5O4 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-[(2R,3R,4R)-3-azido-4-fluoro-2-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc([C@@]2(CO)OC[C@H](F)[C@@H]2N=[N+]=[N-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12FN5O4/c1-16-2-5(8(18)13-9(16)19)10(4-17)7(14-15-12)6(11)3-20-10/h2,6-7,17H,3-4H2,1H3,(H,13,18,19)/t6-,7-,10+/m0/s1 |
| InChIKey | OPXGOBTVOIMEET-MHYGZLNHSA-N |
| XLogP | -0.69 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|