C25H28N7O4+ — CID 123889141
1-[[2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-isoindol-2-ium-5-yl]methyl]-3-[4-(N-methanimidoyl-N-methylcarbamimidoyl)phenyl]urea (PubChem CID 123889141) has the molecular formula C25H28N7O4+ and a molecular weight of 490.54 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-isoindol-2-ium-5-yl]methyl]-3-[4-(N-methanimidoyl-N-methylcarbamimidoyl)phenyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-isoindol-2-ium-5-yl]methyl]-3-[4-(N-methanimidoyl-N-methylcarbamimidoyl)phenyl]urea |
|---|---|
| PubChem CID | 123889141 |
| Molecular Formula | C25H28N7O4+ |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-isoindol-2-ium-5-yl]methyl]-3-[4-(N-methanimidoyl-N-methylcarbamimidoyl)phenyl]urea |
| SMILES | [H]/N=C(/c1ccc(NC(=O)NCc2ccc3c(c2)C[N+](C)(C2CCC(=O)NC2=O)C3=O)cc1)N(C)/C=N/[H] |
| InChI | InChI=1S/C25H27N7O4/c1-31(14-26)22(27)16-4-6-18(7-5-16)29-25(36)28-12-15-3-8-19-17(11-15)13-32(2,24(19)35)20-9-10-21(33)30-23(20)34/h3-8,11,14,20,26H,9-10,12-13H2,1-2H3,(H3-,27,28,29,30,33,34,36)/p+1/b26-14+ |
| InChIKey | KFRIJBSUPBBOOH-VULFUBBASA-O |
| XLogP | 1.78 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|