C15H24N2O — CID 123896834
N-(5-methylocta-2,4,6-trien-4-yl)-2-pyrrolidin-1-ylacetamide (PubChem CID 123896834) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N-(5-methylocta-2,4,6-trien-4-yl)-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-(5-methylocta-2,4,6-trien-4-yl)-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 123896834 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-(5-methylocta-2,4,6-trien-4-yl)-2-pyrrolidin-1-ylacetamide |
| SMILES | CC=CC(C)=C(C=CC)NC(=O)CN1CCCC1 |
| InChI | InChI=1S/C15H24N2O/c1-4-8-13(3)14(9-5-2)16-15(18)12-17-10-6-7-11-17/h4-5,8-9H,6-7,10-12H2,1-3H3,(H,16,18) |
| InChIKey | ICCAFLLNOILNDA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|