C21H30OS — CID 123896937
(4aR,8aR)-5,5,8a-trimethyl-1-(2-phenylsulfanylethenyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol (PubChem CID 123896937) has the molecular formula C21H30OS and a molecular weight of 330.54 g/mol. Its IUPAC name is (4aR,8aR)-5,5,8a-trimethyl-1-(2-phenylsulfanylethenyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol.
| Compound Name | (4aR,8aR)-5,5,8a-trimethyl-1-(2-phenylsulfanylethenyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 123896937 |
| Molecular Formula | C21H30OS |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (4aR,8aR)-5,5,8a-trimethyl-1-(2-phenylsulfanylethenyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]1CCCC2(O)C=CSc1ccccc1 |
| InChI | InChI=1S/C21H30OS/c1-19(2)12-8-13-20(3)18(19)11-7-14-21(20,22)15-16-23-17-9-5-4-6-10-17/h4-6,9-10,15-16,18,22H,7-8,11-14H2,1-3H3/t18-,20-,21?/m1/s1 |
| InChIKey | SKLDTRIIDTXBOD-SAMMEDMISA-N |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |