C27H33F3N6O3 — CID 123898648
1-[3-[7-[2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 123898648) has the molecular formula C27H33F3N6O3 and a molecular weight of 546.59 g/mol. Its IUPAC name is 1-[3-[7-[2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 123898648 |
| Molecular Formula | C27H33F3N6O3 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 1-[3-[7-[2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COCCN1CCC(CCON=Cc2ccn3c(-c4cccc(NC(=O)NCC(F)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C27H33F3N6O3/c1-38-14-12-35-9-5-20(6-10-35)8-13-39-33-17-21-7-11-36-24(18-31-25(36)15-21)22-3-2-4-23(16-22)34-26(37)32-19-27(28,29)30/h2-4,7,11,15-18,20H,5-6,8-10,12-14,19H2,1H3,(H2,32,34,37) |
| InChIKey | SXTBLXKSMQGPMI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|