C19H31BN4O7S — CID 123899575
N-[3-[4-[2-(3-azidopropylsulfonyloxy)ethoxy]phenyl]-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]-methylboronamidic acid (PubChem CID 123899575) has the molecular formula C19H31BN4O7S and a molecular weight of 470.36 g/mol. Its IUPAC name is N-[3-[4-[2-(3-azidopropylsulfonyloxy)ethoxy]phenyl]-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]-methylboronamidic acid.
| Compound Name | N-[3-[4-[2-(3-azidopropylsulfonyloxy)ethoxy]phenyl]-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 123899575 |
| Molecular Formula | C19H31BN4O7S |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-[3-[4-[2-(3-azidopropylsulfonyloxy)ethoxy]phenyl]-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]-methylboronamidic acid |
| SMILES | CB(O)NC(Cc1ccc(OCCOS(=O)(=O)CCCN=[N+]=[N-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31BN4O7S/c1-19(2,3)31-18(25)17(23-20(4)26)14-15-6-8-16(9-7-15)29-11-12-30-32(27,28)13-5-10-22-24-21/h6-9,17,23,26H,5,10-14H2,1-4H3 |
| InChIKey | AIXPHHSZNXKCGR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 159.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|