C13H17N — CID 123903524
5-ethylidene-4-prop-2-enylidene-2-propylpyridine (PubChem CID 123903524) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 5-ethylidene-4-prop-2-enylidene-2-propylpyridine.
| Compound Name | 5-ethylidene-4-prop-2-enylidene-2-propylpyridine |
|---|---|
| PubChem CID | 123903524 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 5-ethylidene-4-prop-2-enylidene-2-propylpyridine |
| SMILES | C=CC=c1cc(CCC)ncc1=CC |
| InChI | InChI=1S/C13H17N/c1-4-7-12-9-13(8-5-2)14-10-11(12)6-3/h4,6-7,9-10H,1,5,8H2,2-3H3 |
| InChIKey | FGAZTUBOPQWDCJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |