C16H20F3N — CID 145238174
(E,2Z,3E)-2-ethylidene-5-methyl-3-prop-2-enylidene-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-4-en-1-imine (PubChem CID 145238174) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is (E,2Z,3E)-2-ethylidene-5-methyl-3-prop-2-enylidene-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-4-en-1-imine.
| Compound Name | (E,2Z,3E)-2-ethylidene-5-methyl-3-prop-2-enylidene-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-4-en-1-imine |
|---|---|
| PubChem CID | 145238174 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (E,2Z,3E)-2-ethylidene-5-methyl-3-prop-2-enylidene-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-4-en-1-imine |
| SMILES | C=C/C=C(\C=C(/C)CC)C(=CC)/C=N/C(=C)C(F)(F)F |
| InChI | InChI=1S/C16H20F3N/c1-6-9-15(10-12(4)7-2)14(8-3)11-20-13(5)16(17,18)19/h6,8-11H,1,5,7H2,2-4H3/b12-10+,14-8+,15-9+,20-11+ |
| InChIKey | IWDRNBWVSBWINB-FQRCBXADSA-N |
| XLogP | 5.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|