C34H33NO7 — CID 123906509
2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[(4-methyl-5-phenyl-1H-pyrrol-2-yl)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione (PubChem CID 123906509) has the molecular formula C34H33NO7 and a molecular weight of 567.64 g/mol. Its IUPAC name is 2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[(4-methyl-5-phenyl-1H-pyrrol-2-yl)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione.
| Compound Name | 2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[(4-methyl-5-phenyl-1H-pyrrol-2-yl)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 123906509 |
| Molecular Formula | C34H33NO7 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[(4-methyl-5-phenyl-1H-pyrrol-2-yl)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione |
| SMILES | CC(=O)C1=C(C)CC2C(O)C3C(C(=O)c4c(ccc(Cc5cc(C)c(-c6ccccc6)[nH]5)c4O)C3C)C(=O)C2(O)C1=O |
| InChI | InChI=1S/C34H33NO7/c1-15-13-23-30(38)25-17(3)22-11-10-20(14-21-12-16(2)28(35-21)19-8-6-5-7-9-19)29(37)26(22)31(39)27(25)33(41)34(23,42)32(40)24(15)18(4)36/h5-12,17,23,25,27,30,35,37-38,42H,13-14H2,1-4H3 |
| InChIKey | OGNGWDGJODJQTQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|