C28H33ClN2O7 — CID 91449238
(2R,4R,4aR,5aR,11aS,12aR)-9-(5-chloro-1H-pyrrol-2-yl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 91449238) has the molecular formula C28H33ClN2O7 and a molecular weight of 545.03 g/mol. Its IUPAC name is (2R,4R,4aR,5aR,11aS,12aR)-9-(5-chloro-1H-pyrrol-2-yl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aR,5aR,11aS,12aR)-9-(5-chloro-1H-pyrrol-2-yl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91449238 |
| Molecular Formula | C28H33ClN2O7 |
| Molecular Weight | 545.03 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | (2R,4R,4aR,5aR,11aS,12aR)-9-(5-chloro-1H-pyrrol-2-yl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(ccc(-c5ccc(Cl)[nH]5)c4O)C[C@]3(C)C[C@]12C |
| InChI | InChI=1S/C28H33ClN2O7/c1-11(2)18-22(34)17(25(30)37)23(35)28(38)24(36)19-21(33)16-12(9-26(19,3)10-27(18,28)4)5-6-13(20(16)32)14-7-8-15(29)31-14/h5-8,11,17-19,22,24,31-32,34,36,38H,9-10H2,1-4H3,(H2,30,37)/t17-,18+,19-,22?,24?,26-,27-,28+/m1/s1 |
| InChIKey | AHTIDIRNXDBJEK-OGKOLBBYSA-N |
| XLogP | 2.22 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.03 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|