C12H17NO — CID 123915496
3-ethyl-3-hexa-1,3,5-trien-3-ylpyrrolidin-2-one (PubChem CID 123915496) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-ethyl-3-hexa-1,3,5-trien-3-ylpyrrolidin-2-one.
| Compound Name | 3-ethyl-3-hexa-1,3,5-trien-3-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 123915496 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-ethyl-3-hexa-1,3,5-trien-3-ylpyrrolidin-2-one |
| SMILES | C=CC=C(C=C)C1(CC)CCNC1=O |
| InChI | InChI=1S/C12H17NO/c1-4-7-10(5-2)12(6-3)8-9-13-11(12)14/h4-5,7H,1-2,6,8-9H2,3H3,(H,13,14) |
| InChIKey | DXPIBXMNDAYTPT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|