C32H50N10O8S2 — CID 123927550
2-[2-[2-[2-[4-[5-(4,6-diaminopyrimidin-2-yl)sulfanyl-4,6-dimethoxypyrimidin-2-yl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 123927550) has the molecular formula C32H50N10O8S2 and a molecular weight of 766.95 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[5-(4,6-diaminopyrimidin-2-yl)sulfanyl-4,6-dimethoxypyrimidin-2-yl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | 2-[2-[2-[2-[4-[5-(4,6-diaminopyrimidin-2-yl)sulfanyl-4,6-dimethoxypyrimidin-2-yl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 123927550 |
| Molecular Formula | C32H50N10O8S2 |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.33 |
| IUPAC Name | 2-[2-[2-[2-[4-[5-(4,6-diaminopyrimidin-2-yl)sulfanyl-4,6-dimethoxypyrimidin-2-yl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | COc1nc(N2CCN(CCOCCOCCOCCOC(=O)CCCCC3SCC4NC(=O)NC43)CC2)nc(OC)c1Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C32H50N10O8S2/c1-45-28-27(52-32-36-23(33)19-24(34)37-32)29(46-2)40-30(39-28)42-9-7-41(8-10-42)11-12-47-13-14-48-15-16-49-17-18-50-25(43)6-4-3-5-22-26-21(20-51-22)35-31(44)38-26/h19,21-22,26H,3-18,20H2,1-2H3,(H2,35,38,44)(H4,33,34,36,37) |
| InChIKey | PPGBFQWMVCJXMZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 223.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|