C25H27N3O4S — CID 102383349
2-(9-oxoacridin-10-yl)ethyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 102383349) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-(9-oxoacridin-10-yl)ethyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | 2-(9-oxoacridin-10-yl)ethyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 102383349 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-(9-oxoacridin-10-yl)ethyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CCCCC(=O)OCCn2c3ccccc3c(=O)c3ccccc32)N1 |
| InChI | InChI=1S/C25H27N3O4S/c29-22(12-6-5-11-21-23-18(15-33-21)26-25(31)27-23)32-14-13-28-19-9-3-1-7-16(19)24(30)17-8-2-4-10-20(17)28/h1-4,7-10,18,21,23H,5-6,11-15H2,(H2,26,27,31)/t18-,21-,23-/m0/s1 |
| InChIKey | MVTYQWIOPRDOOW-HARLFGEKSA-N |
| XLogP | 3.42 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|