C12H18O — CID 123928790
5,5-dimethyltricyclo[5.2.1.03,9]dec-3-en-1-ol (PubChem CID 123928790) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 5,5-dimethyltricyclo[5.2.1.03,9]dec-3-en-1-ol.
| Compound Name | 5,5-dimethyltricyclo[5.2.1.03,9]dec-3-en-1-ol |
|---|---|
| PubChem CID | 123928790 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 5,5-dimethyltricyclo[5.2.1.03,9]dec-3-en-1-ol |
| SMILES | CC1(C)C=C2CC3(O)CC(CC23)C1 |
| InChI | InChI=1S/C12H18O/c1-11(2)4-8-3-10-9(6-11)7-12(10,13)5-8/h6,8,10,13H,3-5,7H2,1-2H3 |
| InChIKey | AAFVGXBWQKYFKO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|