C33H21N7S5 — CID 123930325
2-[[5-[7-[5-[2-(2,1,3-benzothiadiazol-4-yl)prop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylidene]-3-(4-ethenyl-1,2,5-thiadiazol-3-yl)pent-3-enenitrile (PubChem CID 123930325) has the molecular formula C33H21N7S5 and a molecular weight of 675.92 g/mol. Its IUPAC name is 2-[[5-[7-[5-[2-(2,1,3-benzothiadiazol-4-yl)prop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylidene]-3-(4-ethenyl-1,2,5-thiadiazol-3-yl)pent-3-enenitrile.
| Compound Name | 2-[[5-[7-[5-[2-(2,1,3-benzothiadiazol-4-yl)prop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylidene]-3-(4-ethenyl-1,2,5-thiadiazol-3-yl)pent-3-enenitrile |
|---|---|
| PubChem CID | 123930325 |
| Molecular Formula | C33H21N7S5 |
| Molecular Weight | 675.92 g/mol |
| Exact Mass | 675.05 |
| IUPAC Name | 2-[[5-[7-[5-[2-(2,1,3-benzothiadiazol-4-yl)prop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylidene]-3-(4-ethenyl-1,2,5-thiadiazol-3-yl)pent-3-enenitrile |
| SMILES | C=Cc1nsnc1C(=CC)C(C#N)=Cc1ccc(-c2ccc(-c3ccc(C=C(C)c4cccc5nsnc45)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C33H21N7S5/c1-4-22(30-26(5-2)35-43-37-30)19(17-34)16-21-10-14-29(42-21)25-12-11-24(32-33(25)40-45-39-32)28-13-9-20(41-28)15-18(3)23-7-6-8-27-31(23)38-44-36-27/h4-16H,2H2,1,3H3 |
| InChIKey | NVUCFEZUCHARSH-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.92 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|